C21H27FO3 — CID 66708352
[(3R,5R,9R,10R,13S,17R)-16-fluoro-3-hydroxy-10,13-dimethyl-4,5,6,7,9,11,12,17-octahydro-3H-cyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 66708352) has the molecular formula C21H27FO3 and a molecular weight of 346.44 g/mol. Its IUPAC name is [(3R,5R,9R,10R,13S,17R)-16-fluoro-3-hydroxy-10,13-dimethyl-4,5,6,7,9,11,12,17-octahydro-3H-cyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(3R,5R,9R,10R,13S,17R)-16-fluoro-3-hydroxy-10,13-dimethyl-4,5,6,7,9,11,12,17-octahydro-3H-cyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 66708352 |
| Molecular Formula | C21H27FO3 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | [(3R,5R,9R,10R,13S,17R)-16-fluoro-3-hydroxy-10,13-dimethyl-4,5,6,7,9,11,12,17-octahydro-3H-cyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)O[C@H]1C(F)=CC2=C3CC[C@@H]4C[C@@H](O)C=C[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C21H27FO3/c1-12(23)25-19-18(22)11-17-15-5-4-13-10-14(24)6-8-20(13,2)16(15)7-9-21(17,19)3/h6,8,11,13-14,16,19,24H,4-5,7,9-10H2,1-3H3/t13-,14+,16+,19+,20+,21+/m1/s1 |
| InChIKey | TVNKAEBMPURWNQ-PEIHSMAWSA-N |
| XLogP | 4.24 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|