C21H31NO3 — CID 69494007
[(5R,8R,9S,10R,13S,14R,17R)-17-amino-3-hydroxy-10,13-dimethyl-4,5,6,7,8,9,11,12,14,17-decahydro-3H-cyclopenta[a]phenanthren-16-yl] acetate (PubChem CID 69494007) has the molecular formula C21H31NO3 and a molecular weight of 345.48 g/mol. Its IUPAC name is [(5R,8R,9S,10R,13S,14R,17R)-17-amino-3-hydroxy-10,13-dimethyl-4,5,6,7,8,9,11,12,14,17-decahydro-3H-cyclopenta[a]phenanthren-16-yl] acetate.
| Compound Name | [(5R,8R,9S,10R,13S,14R,17R)-17-amino-3-hydroxy-10,13-dimethyl-4,5,6,7,8,9,11,12,14,17-decahydro-3H-cyclopenta[a]phenanthren-16-yl] acetate |
|---|---|
| PubChem CID | 69494007 |
| Molecular Formula | C21H31NO3 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | [(5R,8R,9S,10R,13S,14R,17R)-17-amino-3-hydroxy-10,13-dimethyl-4,5,6,7,8,9,11,12,14,17-decahydro-3H-cyclopenta[a]phenanthren-16-yl] acetate |
| SMILES | CC(=O)OC1=C[C@H]2[C@@H]3CC[C@@H]4CC(O)C=C[C@]4(C)[C@H]3CC[C@]2(C)[C@H]1N |
| InChI | InChI=1S/C21H31NO3/c1-12(23)25-18-11-17-15-5-4-13-10-14(24)6-8-20(13,2)16(15)7-9-21(17,3)19(18)22/h6,8,11,13-17,19,24H,4-5,7,9-10,22H2,1-3H3/t13-,14?,15-,16+,17+,19+,20+,21+/m1/s1 |
| InChIKey | HPCSUIFXTLBIJE-FAPUSCOWSA-N |
| XLogP | 3.16 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|