C21H30O4 — CID 66707999
[(3R,7S,10R,13S,14R,17S)-3,17-dihydroxy-10,13-dimethyl-4,5,6,7,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-7-yl] acetate (PubChem CID 66707999) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is [(3R,7S,10R,13S,14R,17S)-3,17-dihydroxy-10,13-dimethyl-4,5,6,7,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-7-yl] acetate.
| Compound Name | [(3R,7S,10R,13S,14R,17S)-3,17-dihydroxy-10,13-dimethyl-4,5,6,7,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-7-yl] acetate |
|---|---|
| PubChem CID | 66707999 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | [(3R,7S,10R,13S,14R,17S)-3,17-dihydroxy-10,13-dimethyl-4,5,6,7,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-7-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC2C[C@@H](O)C=C[C@]2(C)C2=C1[C@@H]1CC[C@H](O)[C@@]1(C)CC2 |
| InChI | InChI=1S/C21H30O4/c1-12(22)25-17-11-13-10-14(23)6-8-20(13,2)16-7-9-21(3)15(19(16)17)4-5-18(21)24/h6,8,13-15,17-18,23-24H,4-5,7,9-11H2,1-3H3/t13?,14-,15-,17-,18-,20-,21-/m0/s1 |
| InChIKey | AXTJLWIYGVXFTH-CMPNBPNXSA-N |
| XLogP | 3.13 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|