C21H32N2O — CID 66708615
(10R,13S,14R)-10,13-dimethyl-7,17-bis(methylamino)-4,5,6,7,11,12,14,17-octahydro-3H-cyclopenta[a]phenanthren-3-ol (PubChem CID 66708615) has the molecular formula C21H32N2O and a molecular weight of 328.50 g/mol. Its IUPAC name is (10R,13S,14R)-10,13-dimethyl-7,17-bis(methylamino)-4,5,6,7,11,12,14,17-octahydro-3H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (10R,13S,14R)-10,13-dimethyl-7,17-bis(methylamino)-4,5,6,7,11,12,14,17-octahydro-3H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 66708615 |
| Molecular Formula | C21H32N2O |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.25 |
| IUPAC Name | (10R,13S,14R)-10,13-dimethyl-7,17-bis(methylamino)-4,5,6,7,11,12,14,17-octahydro-3H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CNC1CC2CC(O)C=C[C@]2(C)C2=C1[C@@H]1C=CC(NC)[C@@]1(C)CC2 |
| InChI | InChI=1S/C21H32N2O/c1-20-9-7-14(24)11-13(20)12-17(22-3)19-15-5-6-18(23-4)21(15,2)10-8-16(19)20/h5-7,9,13-15,17-18,22-24H,8,10-12H2,1-4H3/t13?,14?,15-,17?,18?,20-,21-/m0/s1 |
| InChIKey | IUVDNAIKIQKHMK-PHPJUPADSA-N |
| XLogP | 2.79 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|