C19H28FNO2 — CID 66708167
(3R,5S,7S,10R,13S,14R,16R,17R)-17-amino-16-fluoro-10,13-dimethyl-4,5,6,7,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthrene-3,7-diol (PubChem CID 66708167) has the molecular formula C19H28FNO2 and a molecular weight of 321.44 g/mol. Its IUPAC name is (3R,5S,7S,10R,13S,14R,16R,17R)-17-amino-16-fluoro-10,13-dimethyl-4,5,6,7,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthrene-3,7-diol.
| Compound Name | (3R,5S,7S,10R,13S,14R,16R,17R)-17-amino-16-fluoro-10,13-dimethyl-4,5,6,7,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthrene-3,7-diol |
|---|---|
| PubChem CID | 66708167 |
| Molecular Formula | C19H28FNO2 |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | (3R,5S,7S,10R,13S,14R,16R,17R)-17-amino-16-fluoro-10,13-dimethyl-4,5,6,7,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthrene-3,7-diol |
| SMILES | C[C@]12CCC3=C([C@@H](O)C[C@@H]4C[C@@H](O)C=C[C@]34C)[C@@H]1C[C@@H](F)[C@@H]2N |
| InChI | InChI=1S/C19H28FNO2/c1-18-5-3-11(22)7-10(18)8-15(23)16-12(18)4-6-19(2)13(16)9-14(20)17(19)21/h3,5,10-11,13-15,17,22-23H,4,6-9,21H2,1-2H3/t10-,11-,13-,14+,15-,17-,18-,19-/m0/s1 |
| InChIKey | NRZBUBQIYOYJPB-DVTCCZGPSA-N |
| XLogP | 2.48 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|