C20H28O3 — CID 66708720
(5R,8R,9S,10R,13S,14S,17S)-3-hydroxy-17-methoxy-10,13-dimethyl-5,6,7,8,9,11,12,14,15,17-decahydrocyclopenta[a]phenanthren-16-one (PubChem CID 66708720) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (5R,8R,9S,10R,13S,14S,17S)-3-hydroxy-17-methoxy-10,13-dimethyl-5,6,7,8,9,11,12,14,15,17-decahydrocyclopenta[a]phenanthren-16-one.
| Compound Name | (5R,8R,9S,10R,13S,14S,17S)-3-hydroxy-17-methoxy-10,13-dimethyl-5,6,7,8,9,11,12,14,15,17-decahydrocyclopenta[a]phenanthren-16-one |
|---|---|
| PubChem CID | 66708720 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (5R,8R,9S,10R,13S,14S,17S)-3-hydroxy-17-methoxy-10,13-dimethyl-5,6,7,8,9,11,12,14,15,17-decahydrocyclopenta[a]phenanthren-16-one |
| SMILES | CO[C@@H]1C(=O)C[C@H]2[C@@H]3CC[C@@H]4C=C(O)C=C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C20H28O3/c1-19-8-6-13(21)10-12(19)4-5-14-15(19)7-9-20(2)16(14)11-17(22)18(20)23-3/h6,8,10,12,14-16,18,21H,4-5,7,9,11H2,1-3H3/t12-,14-,15+,16+,18-,19+,20+/m1/s1 |
| InChIKey | RUWOWIFYEQXCRE-CMHLCETHSA-N |
| XLogP | 4.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |