C20H26O3 — CID 66708476
(8S,10S,13S,14S)-3-hydroxy-17-methoxy-10,13-dimethyl-5,6,7,8,12,14,15,17-octahydrocyclopenta[a]phenanthren-16-one (PubChem CID 66708476) has the molecular formula C20H26O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is (8S,10S,13S,14S)-3-hydroxy-17-methoxy-10,13-dimethyl-5,6,7,8,12,14,15,17-octahydrocyclopenta[a]phenanthren-16-one.
| Compound Name | (8S,10S,13S,14S)-3-hydroxy-17-methoxy-10,13-dimethyl-5,6,7,8,12,14,15,17-octahydrocyclopenta[a]phenanthren-16-one |
|---|---|
| PubChem CID | 66708476 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | (8S,10S,13S,14S)-3-hydroxy-17-methoxy-10,13-dimethyl-5,6,7,8,12,14,15,17-octahydrocyclopenta[a]phenanthren-16-one |
| SMILES | COC1C(=O)C[C@H]2[C@@H]3CCC4C=C(O)C=C[C@]4(C)C3=CC[C@]12C |
| InChI | InChI=1S/C20H26O3/c1-19-8-6-13(21)10-12(19)4-5-14-15(19)7-9-20(2)16(14)11-17(22)18(20)23-3/h6-8,10,12,14,16,18,21H,4-5,9,11H2,1-3H3/t12?,14-,16+,18?,19+,20+/m1/s1 |
| InChIKey | KTYVFVBOWQFNKO-HCKUWMIVSA-N |
| XLogP | 3.97 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|