C21H29NO3 — CID 118349718
(10R,13S)-17-(2-aminooxyacetyl)-10,13-dimethyl-4,5,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 118349718) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is (10R,13S)-17-(2-aminooxyacetyl)-10,13-dimethyl-4,5,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (10R,13S)-17-(2-aminooxyacetyl)-10,13-dimethyl-4,5,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 118349718 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | (10R,13S)-17-(2-aminooxyacetyl)-10,13-dimethyl-4,5,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CC=C3C(CCC4CC(=O)C=C[C@]34C)C1CCC2C(=O)CON |
| InChI | InChI=1S/C21H29NO3/c1-20-9-7-14(23)11-13(20)3-4-15-16-5-6-18(19(24)12-25-22)21(16,2)10-8-17(15)20/h7-9,13,15-16,18H,3-6,10-12,22H2,1-2H3/t13?,15?,16?,18?,20-,21-/m0/s1 |
| InChIKey | IPLSWEDFEJGLOO-LZYRUNFRSA-N |
| XLogP | 3.37 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|