C24H30F2O5 — CID 57108960
[2-[(6S,8S,10R,13S,14S,17S)-4,6-difluoro-10,13-dimethyl-3-oxo-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 2-hydroxypropanoate (PubChem CID 57108960) has the molecular formula C24H30F2O5 and a molecular weight of 436.50 g/mol. Its IUPAC name is [2-[(6S,8S,10R,13S,14S,17S)-4,6-difluoro-10,13-dimethyl-3-oxo-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 2-hydroxypropanoate.
| Compound Name | [2-[(6S,8S,10R,13S,14S,17S)-4,6-difluoro-10,13-dimethyl-3-oxo-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 2-hydroxypropanoate |
|---|---|
| PubChem CID | 57108960 |
| Molecular Formula | C24H30F2O5 |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | [2-[(6S,8S,10R,13S,14S,17S)-4,6-difluoro-10,13-dimethyl-3-oxo-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 2-hydroxypropanoate |
| SMILES | CC(O)C(=O)OCC(=O)[C@H]1CC[C@H]2[C@@H]3C[C@H](F)C4=C(F)C(=O)CC[C@]4(C)C3=CC[C@]12C |
| InChI | InChI=1S/C24H30F2O5/c1-12(27)22(30)31-11-19(29)16-5-4-14-13-10-17(25)20-21(26)18(28)7-9-24(20,3)15(13)6-8-23(14,16)2/h6,12-14,16-17,27H,4-5,7-11H2,1-3H3/t12?,13-,14-,16+,17-,23-,24+/m0/s1 |
| InChIKey | DLLKCZQIDCOJMR-TZULDUMMSA-N |
| XLogP | 3.79 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|