C19H27FO3 — CID 66708454
(5R,8S,9R,10S,13S,14S,16R,17R)-9-fluoro-10,13-dimethyl-5,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-triol (PubChem CID 66708454) has the molecular formula C19H27FO3 and a molecular weight of 322.42 g/mol. Its IUPAC name is (5R,8S,9R,10S,13S,14S,16R,17R)-9-fluoro-10,13-dimethyl-5,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-triol.
| Compound Name | (5R,8S,9R,10S,13S,14S,16R,17R)-9-fluoro-10,13-dimethyl-5,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-triol |
|---|---|
| PubChem CID | 66708454 |
| Molecular Formula | C19H27FO3 |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | (5R,8S,9R,10S,13S,14S,16R,17R)-9-fluoro-10,13-dimethyl-5,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-triol |
| SMILES | C[C@]12CC[C@@]3(F)[C@@H](CC[C@@H]4C=C(O)C=C[C@@]43C)[C@@H]1C[C@@H](O)[C@@H]2O |
| InChI | InChI=1S/C19H27FO3/c1-17-7-8-19(20)13(14(17)10-15(22)16(17)23)4-3-11-9-12(21)5-6-18(11,19)2/h5-6,9,11,13-16,21-23H,3-4,7-8,10H2,1-2H3/t11-,13+,14+,15-,16+,17+,18+,19-/m1/s1 |
| InChIKey | AWTGPCQEWPQPSO-SGMZZEJWSA-N |
| XLogP | 3.28 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |