C19H25FO3 — CID 66709124
(8S,9S,10S,13S,14S)-9-fluoro-10,13-dimethyl-7,8,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene-3,16,17-triol (PubChem CID 66709124) has the molecular formula C19H25FO3 and a molecular weight of 320.40 g/mol. Its IUPAC name is (8S,9S,10S,13S,14S)-9-fluoro-10,13-dimethyl-7,8,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene-3,16,17-triol.
| Compound Name | (8S,9S,10S,13S,14S)-9-fluoro-10,13-dimethyl-7,8,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene-3,16,17-triol |
|---|---|
| PubChem CID | 66709124 |
| Molecular Formula | C19H25FO3 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | (8S,9S,10S,13S,14S)-9-fluoro-10,13-dimethyl-7,8,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene-3,16,17-triol |
| SMILES | C[C@]12C=CC(O)=CC1=CC[C@H]1[C@@H]3CC(O)C(O)[C@@]3(C)CC[C@]12F |
| InChI | InChI=1S/C19H25FO3/c1-17-7-8-19(20)13(14(17)10-15(22)16(17)23)4-3-11-9-12(21)5-6-18(11,19)2/h3,5-6,9,13-16,21-23H,4,7-8,10H2,1-2H3/t13-,14-,15?,16?,17-,18-,19-/m0/s1 |
| InChIKey | MHOVYVUXMONCDV-HFTLVWAASA-N |
| XLogP | 3.20 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |