C19H28FNO2 — CID 91181037
(8S,9S,10R,13S,14S)-17-amino-9-fluoro-16-hydroxy-10,13-dimethyl-5,6,7,8,11,12,14,15,16,17-decahydro-4H-cyclopenta[a]phenanthren-3-one (PubChem CID 91181037) has the molecular formula C19H28FNO2 and a molecular weight of 321.44 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S)-17-amino-9-fluoro-16-hydroxy-10,13-dimethyl-5,6,7,8,11,12,14,15,16,17-decahydro-4H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10R,13S,14S)-17-amino-9-fluoro-16-hydroxy-10,13-dimethyl-5,6,7,8,11,12,14,15,16,17-decahydro-4H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 91181037 |
| Molecular Formula | C19H28FNO2 |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | (8S,9S,10R,13S,14S)-17-amino-9-fluoro-16-hydroxy-10,13-dimethyl-5,6,7,8,11,12,14,15,16,17-decahydro-4H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12C=CC(=O)CC1CC[C@H]1[C@@H]3CC(O)C(N)[C@@]3(C)CC[C@]12F |
| InChI | InChI=1S/C19H28FNO2/c1-17-7-8-19(20)13(14(17)10-15(23)16(17)21)4-3-11-9-12(22)5-6-18(11,19)2/h5-6,11,13-16,23H,3-4,7-10,21H2,1-2H3/t11?,13-,14-,15?,16?,17-,18-,19-/m0/s1 |
| InChIKey | VNRRHZMHKPUVMW-WVSXXGKISA-N |
| XLogP | 2.76 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |