C27H42O2 — CID 163139889
9-hydroxy-10,13-dimethyl-17-(6-methylhept-3-en-2-yl)-5,6,7,8,11,12,14,15,16,17-decahydro-4H-cyclopenta[a]phenanthren-3-one (PubChem CID 163139889) has the molecular formula C27H42O2 and a molecular weight of 398.63 g/mol. Its IUPAC name is 9-hydroxy-10,13-dimethyl-17-(6-methylhept-3-en-2-yl)-5,6,7,8,11,12,14,15,16,17-decahydro-4H-cyclopenta[a]phenanthren-3-one.
| Compound Name | 9-hydroxy-10,13-dimethyl-17-(6-methylhept-3-en-2-yl)-5,6,7,8,11,12,14,15,16,17-decahydro-4H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 163139889 |
| Molecular Formula | C27H42O2 |
| Molecular Weight | 398.63 g/mol |
| Exact Mass | 398.32 |
| IUPAC Name | 9-hydroxy-10,13-dimethyl-17-(6-methylhept-3-en-2-yl)-5,6,7,8,11,12,14,15,16,17-decahydro-4H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC(C)CC=CC(C)C1CCC2C3CCC4CC(=O)C=CC4(C)C3(O)CCC12C |
| InChI | InChI=1S/C27H42O2/c1-18(2)7-6-8-19(3)22-11-12-23-24-10-9-20-17-21(28)13-14-26(20,5)27(24,29)16-15-25(22,23)4/h6,8,13-14,18-20,22-24,29H,7,9-12,15-17H2,1-5H3 |
| InChIKey | JKDSHICTFIWHOM-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.63 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|