C18H27NO2 — CID 90837583
(1R,2R,10S,11S,15R)-14-hydroxy-2,15-dimethyl-17-azatetracyclo[8.7.0.02,7.011,15]heptadec-3-en-5-one (PubChem CID 90837583) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is (1R,2R,10S,11S,15R)-14-hydroxy-2,15-dimethyl-17-azatetracyclo[8.7.0.02,7.011,15]heptadec-3-en-5-one.
| Compound Name | (1R,2R,10S,11S,15R)-14-hydroxy-2,15-dimethyl-17-azatetracyclo[8.7.0.02,7.011,15]heptadec-3-en-5-one |
|---|---|
| PubChem CID | 90837583 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | (1R,2R,10S,11S,15R)-14-hydroxy-2,15-dimethyl-17-azatetracyclo[8.7.0.02,7.011,15]heptadec-3-en-5-one |
| SMILES | C[C@]12C=CC(=O)CC1CC[C@@H]1[C@H]2NC[C@]2(C)C(O)CC[C@@H]12 |
| InChI | InChI=1S/C18H27NO2/c1-17-8-7-12(20)9-11(17)3-4-13-14-5-6-15(21)18(14,2)10-19-16(13)17/h7-8,11,13-16,19,21H,3-6,9-10H2,1-2H3/t11?,13-,14-,15?,16+,17-,18-/m0/s1 |
| InChIKey | UCMITTAEDYFRHF-OFTXZZPUSA-N |
| XLogP | 2.30 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |