C25H40O5 — CID 56979516
(8S,9R,10R,13R,14S)-11,17-bis(3,3-dihydroxypropyl)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 56979516) has the molecular formula C25H40O5 and a molecular weight of 420.59 g/mol. Its IUPAC name is (8S,9R,10R,13R,14S)-11,17-bis(3,3-dihydroxypropyl)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9R,10R,13R,14S)-11,17-bis(3,3-dihydroxypropyl)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 56979516 |
| Molecular Formula | C25H40O5 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | (8S,9R,10R,13R,14S)-11,17-bis(3,3-dihydroxypropyl)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12C=CC(=O)CC1CC[C@@H]1[C@H]2C(CCC(O)O)C[C@]2(C)C(CCC(O)O)CC[C@@H]12 |
| InChI | InChI=1S/C25H40O5/c1-24-12-11-18(26)13-17(24)4-7-19-20-8-5-16(6-10-22(29)30)25(20,2)14-15(23(19)24)3-9-21(27)28/h11-12,15-17,19-23,27-30H,3-10,13-14H2,1-2H3/t15?,16?,17?,19-,20-,23+,24-,25+/m0/s1 |
| InChIKey | SJYDGULCRSKIFC-BZPVUSAFSA-N |
| XLogP | 3.40 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|