C25H29ClFN7O — CID 66708846
1-[4-(4-chloroimidazol-1-yl)-3-methoxyphenyl]-8-(4-fluorophenyl)-3,6-dimethyl-4,5,7,8-tetrahydro-2H-pyrido[4,3-d]pyrimidine-2,4-diamine (PubChem CID 66708846) has the molecular formula C25H29ClFN7O and a molecular weight of 498.01 g/mol. Its IUPAC name is 1-[4-(4-chloroimidazol-1-yl)-3-methoxyphenyl]-8-(4-fluorophenyl)-3,6-dimethyl-4,5,7,8-tetrahydro-2H-pyrido[4,3-d]pyrimidine-2,4-diamine.
| Compound Name | 1-[4-(4-chloroimidazol-1-yl)-3-methoxyphenyl]-8-(4-fluorophenyl)-3,6-dimethyl-4,5,7,8-tetrahydro-2H-pyrido[4,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 66708846 |
| Molecular Formula | C25H29ClFN7O |
| Molecular Weight | 498.01 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | 1-[4-(4-chloroimidazol-1-yl)-3-methoxyphenyl]-8-(4-fluorophenyl)-3,6-dimethyl-4,5,7,8-tetrahydro-2H-pyrido[4,3-d]pyrimidine-2,4-diamine |
| SMILES | COc1cc(N2C3=C(CN(C)CC3c3ccc(F)cc3)C(N)N(C)C2N)ccc1-n1cnc(Cl)c1 |
| InChI | InChI=1S/C25H29ClFN7O/c1-31-11-18(15-4-6-16(27)7-5-15)23-19(12-31)24(28)32(2)25(29)34(23)17-8-9-20(21(10-17)35-3)33-13-22(26)30-14-33/h4-10,13-14,18,24-25H,11-12,28-29H2,1-3H3 |
| InChIKey | UXQPZFGZDWNGOQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 88.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.01 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |