C28H29ClF3N7O — CID 66709155
2-N-[4-(4-chloroimidazol-1-yl)-3-ethoxyphenyl]-4-N-ethyl-8-phenyl-6-(2,2,2-trifluoroethyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-2,4-diamine (PubChem CID 66709155) has the molecular formula C28H29ClF3N7O and a molecular weight of 572.04 g/mol. Its IUPAC name is 2-N-[4-(4-chloroimidazol-1-yl)-3-ethoxyphenyl]-4-N-ethyl-8-phenyl-6-(2,2,2-trifluoroethyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-2,4-diamine.
| Compound Name | 2-N-[4-(4-chloroimidazol-1-yl)-3-ethoxyphenyl]-4-N-ethyl-8-phenyl-6-(2,2,2-trifluoroethyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 66709155 |
| Molecular Formula | C28H29ClF3N7O |
| Molecular Weight | 572.04 g/mol |
| Exact Mass | 571.21 |
| IUPAC Name | 2-N-[4-(4-chloroimidazol-1-yl)-3-ethoxyphenyl]-4-N-ethyl-8-phenyl-6-(2,2,2-trifluoroethyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-2,4-diamine |
| SMILES | CCNc1nc(Nc2ccc(-n3cnc(Cl)c3)c(OCC)c2)nc2c1CN(CC(F)(F)F)CC2c1ccccc1 |
| InChI | InChI=1S/C28H29ClF3N7O/c1-3-33-26-21-14-38(16-28(30,31)32)13-20(18-8-6-5-7-9-18)25(21)36-27(37-26)35-19-10-11-22(23(12-19)40-4-2)39-15-24(29)34-17-39/h5-12,15,17,20H,3-4,13-14,16H2,1-2H3,(H2,33,35,36,37) |
| InChIKey | ICLTZQRTUPVLDU-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 80.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.04 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |