C17H13NO5 — CID 66712533
methyl 2-(1,3-dioxo-5-phenoxyisoindol-2-yl)acetate (PubChem CID 66712533) has the molecular formula C17H13NO5 and a molecular weight of 311.29 g/mol. Its IUPAC name is methyl 2-(1,3-dioxo-5-phenoxyisoindol-2-yl)acetate.
| Compound Name | methyl 2-(1,3-dioxo-5-phenoxyisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 66712533 |
| Molecular Formula | C17H13NO5 |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | methyl 2-(1,3-dioxo-5-phenoxyisoindol-2-yl)acetate |
| SMILES | COC(=O)CN1C(=O)c2ccc(Oc3ccccc3)cc2C1=O |
| InChI | InChI=1S/C17H13NO5/c1-22-15(19)10-18-16(20)13-8-7-12(9-14(13)17(18)21)23-11-5-3-2-4-6-11/h2-9H,10H2,1H3 |
| InChIKey | FREUEWPLMHWRJN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|