C6H8F3NO2 — CID 66713522
4-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-2-one (PubChem CID 66713522) has the molecular formula C6H8F3NO2 and a molecular weight of 183.13 g/mol. Its IUPAC name is 4-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-2-one.
| Compound Name | 4-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 66713522 |
| Molecular Formula | C6H8F3NO2 |
| Molecular Weight | 183.13 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 4-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-2-one |
| SMILES | O=C1CC([C@@H](O)C(F)(F)F)CN1 |
| InChI | InChI=1S/C6H8F3NO2/c7-6(8,9)5(12)3-1-4(11)10-2-3/h3,5,12H,1-2H2,(H,10,11)/t3?,5-/m1/s1 |
| InChIKey | NVPCYQJAIDNIJY-SDMSXHDGSA-N |
| XLogP | 0.05 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.13 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |