C21H24N4O6S — CID 66714568
3-(4-hydroxybutoxy)-N-(1-methylpyrazol-3-yl)-5-[(6-methylsulfonyl-3-pyridinyl)oxy]benzamide (PubChem CID 66714568) has the molecular formula C21H24N4O6S and a molecular weight of 460.51 g/mol. Its IUPAC name is 3-(4-hydroxybutoxy)-N-(1-methylpyrazol-3-yl)-5-[(6-methylsulfonyl-3-pyridinyl)oxy]benzamide.
| Compound Name | 3-(4-hydroxybutoxy)-N-(1-methylpyrazol-3-yl)-5-[(6-methylsulfonyl-3-pyridinyl)oxy]benzamide |
|---|---|
| PubChem CID | 66714568 |
| Molecular Formula | C21H24N4O6S |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 3-(4-hydroxybutoxy)-N-(1-methylpyrazol-3-yl)-5-[(6-methylsulfonyl-3-pyridinyl)oxy]benzamide |
| SMILES | Cn1ccc(NC(=O)c2cc(OCCCCO)cc(Oc3ccc(S(C)(=O)=O)nc3)c2)n1 |
| InChI | InChI=1S/C21H24N4O6S/c1-25-8-7-19(24-25)23-21(27)15-11-17(30-10-4-3-9-26)13-18(12-15)31-16-5-6-20(22-14-16)32(2,28)29/h5-8,11-14,26H,3-4,9-10H2,1-2H3,(H,23,24,27) |
| InChIKey | JVXJSFAANMPBMW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 132.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|