C22H22BrN5O — CID 66715701
[6-bromo-4-[(6-piperazin-1-yl-3-pyridinyl)amino]quinolin-3-yl]-cyclopropylmethanone (PubChem CID 66715701) has the molecular formula C22H22BrN5O and a molecular weight of 452.36 g/mol. Its IUPAC name is [6-bromo-4-[(6-piperazin-1-yl-3-pyridinyl)amino]quinolin-3-yl]-cyclopropylmethanone.
| Compound Name | [6-bromo-4-[(6-piperazin-1-yl-3-pyridinyl)amino]quinolin-3-yl]-cyclopropylmethanone |
|---|---|
| PubChem CID | 66715701 |
| Molecular Formula | C22H22BrN5O |
| Molecular Weight | 452.36 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | [6-bromo-4-[(6-piperazin-1-yl-3-pyridinyl)amino]quinolin-3-yl]-cyclopropylmethanone |
| SMILES | O=C(c1cnc2ccc(Br)cc2c1Nc1ccc(N2CCNCC2)nc1)C1CC1 |
| InChI | InChI=1S/C22H22BrN5O/c23-15-3-5-19-17(11-15)21(18(13-25-19)22(29)14-1-2-14)27-16-4-6-20(26-12-16)28-9-7-24-8-10-28/h3-6,11-14,24H,1-2,7-10H2,(H,25,27) |
| InChIKey | IYVUXZDFRZXWHJ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.36 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |