C25H27BrN4O4 — CID 66715668
tert-butyl N-[2-[[5-[[6-bromo-3-(cyclopropanecarbonyl)quinolin-4-yl]amino]-2-pyridinyl]oxy]ethyl]carbamate (PubChem CID 66715668) has the molecular formula C25H27BrN4O4 and a molecular weight of 527.42 g/mol. Its IUPAC name is tert-butyl N-[2-[[5-[[6-bromo-3-(cyclopropanecarbonyl)quinolin-4-yl]amino]-2-pyridinyl]oxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[5-[[6-bromo-3-(cyclopropanecarbonyl)quinolin-4-yl]amino]-2-pyridinyl]oxy]ethyl]carbamate |
|---|---|
| PubChem CID | 66715668 |
| Molecular Formula | C25H27BrN4O4 |
| Molecular Weight | 527.42 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | tert-butyl N-[2-[[5-[[6-bromo-3-(cyclopropanecarbonyl)quinolin-4-yl]amino]-2-pyridinyl]oxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOc1ccc(Nc2c(C(=O)C3CC3)cnc3ccc(Br)cc23)cn1 |
| InChI | InChI=1S/C25H27BrN4O4/c1-25(2,3)34-24(32)27-10-11-33-21-9-7-17(13-29-21)30-22-18-12-16(26)6-8-20(18)28-14-19(22)23(31)15-4-5-15/h6-9,12-15H,4-5,10-11H2,1-3H3,(H,27,32)(H,28,30) |
| InChIKey | YKGOJBCBAUQJFY-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.42 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|