C12H12N2O5 — CID 66717180
3-[[3-(2,5-dioxopyrrol-3-yl)-2-methylprop-2-enoyl]amino]-2-methylprop-2-enoic acid (PubChem CID 66717180) has the molecular formula C12H12N2O5 and a molecular weight of 264.24 g/mol. Its IUPAC name is 3-[[3-(2,5-dioxopyrrol-3-yl)-2-methylprop-2-enoyl]amino]-2-methylprop-2-enoic acid.
| Compound Name | 3-[[3-(2,5-dioxopyrrol-3-yl)-2-methylprop-2-enoyl]amino]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 66717180 |
| Molecular Formula | C12H12N2O5 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 3-[[3-(2,5-dioxopyrrol-3-yl)-2-methylprop-2-enoyl]amino]-2-methylprop-2-enoic acid |
| SMILES | CC(=CNC(=O)C(C)=CC1=CC(=O)NC1=O)C(=O)O |
| InChI | InChI=1S/C12H12N2O5/c1-6(3-8-4-9(15)14-11(8)17)10(16)13-5-7(2)12(18)19/h3-5H,1-2H3,(H,13,16)(H,18,19)(H,14,15,17) |
| InChIKey | KTGMBDKBAIHKMI-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|