C22H19ClN2O4 — CID 66717628
methyl 2-[[8-chloro-3-[(4-cyanophenyl)methyl]-2-ethyl-4-oxo-1H-quinolin-5-yl]oxy]acetate (PubChem CID 66717628) has the molecular formula C22H19ClN2O4 and a molecular weight of 410.86 g/mol. Its IUPAC name is methyl 2-[[8-chloro-3-[(4-cyanophenyl)methyl]-2-ethyl-4-oxo-1H-quinolin-5-yl]oxy]acetate.
| Compound Name | methyl 2-[[8-chloro-3-[(4-cyanophenyl)methyl]-2-ethyl-4-oxo-1H-quinolin-5-yl]oxy]acetate |
|---|---|
| PubChem CID | 66717628 |
| Molecular Formula | C22H19ClN2O4 |
| Molecular Weight | 410.86 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | methyl 2-[[8-chloro-3-[(4-cyanophenyl)methyl]-2-ethyl-4-oxo-1H-quinolin-5-yl]oxy]acetate |
| SMILES | CCc1[nH]c2c(Cl)ccc(OCC(=O)OC)c2c(=O)c1Cc1ccc(C#N)cc1 |
| InChI | InChI=1S/C22H19ClN2O4/c1-3-17-15(10-13-4-6-14(11-24)7-5-13)22(27)20-18(29-12-19(26)28-2)9-8-16(23)21(20)25-17/h4-9H,3,10,12H2,1-2H3,(H,25,27) |
| InChIKey | IAYYAMDSNJOQRW-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.86 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |