C28H27N — CID 66719002
3-(3,4-dimethylphenyl)-4-[2-(3,4-dimethylphenyl)phenyl]aniline (PubChem CID 66719002) has the molecular formula C28H27N and a molecular weight of 377.53 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-4-[2-(3,4-dimethylphenyl)phenyl]aniline.
| Compound Name | 3-(3,4-dimethylphenyl)-4-[2-(3,4-dimethylphenyl)phenyl]aniline |
|---|---|
| PubChem CID | 66719002 |
| Molecular Formula | C28H27N |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-4-[2-(3,4-dimethylphenyl)phenyl]aniline |
| SMILES | Cc1ccc(-c2ccccc2-c2ccc(N)cc2-c2ccc(C)c(C)c2)cc1C |
| InChI | InChI=1S/C28H27N/c1-18-9-11-22(15-20(18)3)25-7-5-6-8-26(25)27-14-13-24(29)17-28(27)23-12-10-19(2)21(4)16-23/h5-17H,29H2,1-4H3 |
| InChIKey | OUIOCHZVSYPTOG-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|