C31H26Cl4O7 — CID 66719351
methyl 2,3-bis[4-[(3,4-dichlorophenyl)methoxy]phenyl]-2,3,4-trihydroxybutanoate (PubChem CID 66719351) has the molecular formula C31H26Cl4O7 and a molecular weight of 652.35 g/mol. Its IUPAC name is methyl 2,3-bis[4-[(3,4-dichlorophenyl)methoxy]phenyl]-2,3,4-trihydroxybutanoate.
| Compound Name | methyl 2,3-bis[4-[(3,4-dichlorophenyl)methoxy]phenyl]-2,3,4-trihydroxybutanoate |
|---|---|
| PubChem CID | 66719351 |
| Molecular Formula | C31H26Cl4O7 |
| Molecular Weight | 652.35 g/mol |
| Exact Mass | 650.04 |
| IUPAC Name | methyl 2,3-bis[4-[(3,4-dichlorophenyl)methoxy]phenyl]-2,3,4-trihydroxybutanoate |
| SMILES | COC(=O)C(O)(c1ccc(OCc2ccc(Cl)c(Cl)c2)cc1)C(O)(CO)c1ccc(OCc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C31H26Cl4O7/c1-40-29(37)31(39,22-6-10-24(11-7-22)42-17-20-3-13-26(33)28(35)15-20)30(38,18-36)21-4-8-23(9-5-21)41-16-19-2-12-25(32)27(34)14-19/h2-15,36,38-39H,16-18H2,1H3 |
| InChIKey | BWHIAUCJYPTOCA-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.35 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |