C37H35N3O6 — CID 66719842
methyl (2S)-3-[4-(4-cyanophenyl)phenyl]-2-[[(3S)-3-(4-ethoxyphenyl)-2,3,6,7,8,9-hexahydro-[1,4]dioxino[2,3-g]isoquinoline-8-carbonyl]amino]propanoate (PubChem CID 66719842) has the molecular formula C37H35N3O6 and a molecular weight of 617.70 g/mol. Its IUPAC name is methyl (2S)-3-[4-(4-cyanophenyl)phenyl]-2-[[(3S)-3-(4-ethoxyphenyl)-2,3,6,7,8,9-hexahydro-[1,4]dioxino[2,3-g]isoquinoline-8-carbonyl]amino]propanoate.
| Compound Name | methyl (2S)-3-[4-(4-cyanophenyl)phenyl]-2-[[(3S)-3-(4-ethoxyphenyl)-2,3,6,7,8,9-hexahydro-[1,4]dioxino[2,3-g]isoquinoline-8-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 66719842 |
| Molecular Formula | C37H35N3O6 |
| Molecular Weight | 617.70 g/mol |
| Exact Mass | 617.25 |
| IUPAC Name | methyl (2S)-3-[4-(4-cyanophenyl)phenyl]-2-[[(3S)-3-(4-ethoxyphenyl)-2,3,6,7,8,9-hexahydro-[1,4]dioxino[2,3-g]isoquinoline-8-carbonyl]amino]propanoate |
| SMILES | CCOc1ccc([C@H]2COc3cc4c(cc3O2)CNC(C(=O)N[C@@H](Cc2ccc(-c3ccc(C#N)cc3)cc2)C(=O)OC)C4)cc1 |
| InChI | InChI=1S/C37H35N3O6/c1-3-44-30-14-12-27(13-15-30)35-22-45-33-18-28-17-31(39-21-29(28)19-34(33)46-35)36(41)40-32(37(42)43-2)16-23-4-8-25(9-5-23)26-10-6-24(20-38)7-11-26/h4-15,18-19,31-32,35,39H,3,16-17,21-22H2,1-2H3,(H,40,41)/t31?,32-,35+/m0/s1 |
| InChIKey | NZTIQLTYSLYQEM-LMSOXZGZSA-N |
| XLogP | 5.05 |
| TPSA | 118.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.70 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |