C22H25N5O3 — CID 66720115
N-(1-amino-2-hydroxy-1-oxoheptan-3-yl)-2-(4-phenylpyrazol-1-yl)pyridine-3-carboxamide (PubChem CID 66720115) has the molecular formula C22H25N5O3 and a molecular weight of 407.47 g/mol. Its IUPAC name is N-(1-amino-2-hydroxy-1-oxoheptan-3-yl)-2-(4-phenylpyrazol-1-yl)pyridine-3-carboxamide.
| Compound Name | N-(1-amino-2-hydroxy-1-oxoheptan-3-yl)-2-(4-phenylpyrazol-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 66720115 |
| Molecular Formula | C22H25N5O3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | N-(1-amino-2-hydroxy-1-oxoheptan-3-yl)-2-(4-phenylpyrazol-1-yl)pyridine-3-carboxamide |
| SMILES | CCCCC(NC(=O)c1cccnc1-n1cc(-c2ccccc2)cn1)C(O)C(N)=O |
| InChI | InChI=1S/C22H25N5O3/c1-2-3-11-18(19(28)20(23)29)26-22(30)17-10-7-12-24-21(17)27-14-16(13-25-27)15-8-5-4-6-9-15/h4-10,12-14,18-19,28H,2-3,11H2,1H3,(H2,23,29)(H,26,30) |
| InChIKey | LIENRGLMOKOKJU-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |