C24H31N5O3 — CID 70030685
N-(1-amino-1,2-dioxoheptan-3-yl)-2-(4-benzylpiperazin-1-yl)pyridine-3-carboxamide (PubChem CID 70030685) has the molecular formula C24H31N5O3 and a molecular weight of 437.54 g/mol. Its IUPAC name is N-(1-amino-1,2-dioxoheptan-3-yl)-2-(4-benzylpiperazin-1-yl)pyridine-3-carboxamide.
| Compound Name | N-(1-amino-1,2-dioxoheptan-3-yl)-2-(4-benzylpiperazin-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 70030685 |
| Molecular Formula | C24H31N5O3 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | N-(1-amino-1,2-dioxoheptan-3-yl)-2-(4-benzylpiperazin-1-yl)pyridine-3-carboxamide |
| SMILES | CCCCC(NC(=O)c1cccnc1N1CCN(Cc2ccccc2)CC1)C(=O)C(N)=O |
| InChI | InChI=1S/C24H31N5O3/c1-2-3-11-20(21(30)22(25)31)27-24(32)19-10-7-12-26-23(19)29-15-13-28(14-16-29)17-18-8-5-4-6-9-18/h4-10,12,20H,2-3,11,13-17H2,1H3,(H2,25,31)(H,27,32) |
| InChIKey | ZIKDIZNYIKKPMM-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|