C29H30N4O3 — CID 66996094
N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-[2-[4-(pyrrolidin-1-ylmethyl)phenyl]ethenyl]pyridine-3-carboxamide (PubChem CID 66996094) has the molecular formula C29H30N4O3 and a molecular weight of 482.58 g/mol. Its IUPAC name is N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-[2-[4-(pyrrolidin-1-ylmethyl)phenyl]ethenyl]pyridine-3-carboxamide.
| Compound Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-[2-[4-(pyrrolidin-1-ylmethyl)phenyl]ethenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 66996094 |
| Molecular Formula | C29H30N4O3 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-[2-[4-(pyrrolidin-1-ylmethyl)phenyl]ethenyl]pyridine-3-carboxamide |
| SMILES | NC(=O)C(=O)C(Cc1ccccc1)NC(=O)c1cccnc1C=Cc1ccc(CN2CCCC2)cc1 |
| InChI | InChI=1S/C29H30N4O3/c30-28(35)27(34)26(19-22-7-2-1-3-8-22)32-29(36)24-9-6-16-31-25(24)15-14-21-10-12-23(13-11-21)20-33-17-4-5-18-33/h1-3,6-16,26H,4-5,17-20H2,(H2,30,35)(H,32,36) |
| InChIKey | AUGSJKWNPUYPHM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|