C29H34N4O3 — CID 67215511
N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-[2-(4-methylphenyl)ethenyl]pyridine-3-carboxamide;N-ethylethanamine (PubChem CID 67215511) has the molecular formula C29H34N4O3 and a molecular weight of 486.62 g/mol. Its IUPAC name is N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-[2-(4-methylphenyl)ethenyl]pyridine-3-carboxamide;N-ethylethanamine.
| Compound Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-[2-(4-methylphenyl)ethenyl]pyridine-3-carboxamide;N-ethylethanamine |
|---|---|
| PubChem CID | 67215511 |
| Molecular Formula | C29H34N4O3 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-[2-(4-methylphenyl)ethenyl]pyridine-3-carboxamide;N-ethylethanamine |
| SMILES | CCNCC.Cc1ccc(C=Cc2ncccc2C(=O)NC(Cc2ccccc2)C(=O)C(N)=O)cc1 |
| InChI | InChI=1S/C25H23N3O3.C4H11N/c1-17-9-11-18(12-10-17)13-14-21-20(8-5-15-27-21)25(31)28-22(23(29)24(26)30)16-19-6-3-2-4-7-19;1-3-5-4-2/h2-15,22H,16H2,1H3,(H2,26,30)(H,28,31);5H,3-4H2,1-2H3 |
| InChIKey | BFBXFKWIJSPYDV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|