C32H37N3O3 — CID 54471367
N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-[2-[4-[[propan-2-yl(propyl)amino]methyl]phenyl]ethenyl]benzamide (PubChem CID 54471367) has the molecular formula C32H37N3O3 and a molecular weight of 511.67 g/mol. Its IUPAC name is N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-[2-[4-[[propan-2-yl(propyl)amino]methyl]phenyl]ethenyl]benzamide.
| Compound Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-[2-[4-[[propan-2-yl(propyl)amino]methyl]phenyl]ethenyl]benzamide |
|---|---|
| PubChem CID | 54471367 |
| Molecular Formula | C32H37N3O3 |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.28 |
| IUPAC Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-[2-[4-[[propan-2-yl(propyl)amino]methyl]phenyl]ethenyl]benzamide |
| SMILES | CCCN(Cc1ccc(C=Cc2ccccc2C(=O)NC(Cc2ccccc2)C(=O)C(N)=O)cc1)C(C)C |
| InChI | InChI=1S/C32H37N3O3/c1-4-20-35(23(2)3)22-26-16-14-24(15-17-26)18-19-27-12-8-9-13-28(27)32(38)34-29(30(36)31(33)37)21-25-10-6-5-7-11-25/h5-19,23,29H,4,20-22H2,1-3H3,(H2,33,37)(H,34,38) |
| InChIKey | XIPHSRAAFOLWKA-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|