C39H42N4O3 — CID 70163714
N-[(2S)-4-benzamido-3-oxo-1-phenylbutan-2-yl]-2-[2-[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]ethenyl]benzamide (PubChem CID 70163714) has the molecular formula C39H42N4O3 and a molecular weight of 614.79 g/mol. Its IUPAC name is N-[(2S)-4-benzamido-3-oxo-1-phenylbutan-2-yl]-2-[2-[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]ethenyl]benzamide.
| Compound Name | N-[(2S)-4-benzamido-3-oxo-1-phenylbutan-2-yl]-2-[2-[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]ethenyl]benzamide |
|---|---|
| PubChem CID | 70163714 |
| Molecular Formula | C39H42N4O3 |
| Molecular Weight | 614.79 g/mol |
| Exact Mass | 614.33 |
| IUPAC Name | N-[(2S)-4-benzamido-3-oxo-1-phenylbutan-2-yl]-2-[2-[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]ethenyl]benzamide |
| SMILES | CCN1CCN(Cc2ccc(C=Cc3ccccc3C(=O)N[C@@H](Cc3ccccc3)C(=O)CNC(=O)c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C39H42N4O3/c1-2-42-23-25-43(26-24-42)29-32-19-17-30(18-20-32)21-22-33-13-9-10-16-35(33)39(46)41-36(27-31-11-5-3-6-12-31)37(44)28-40-38(45)34-14-7-4-8-15-34/h3-22,36H,2,23-29H2,1H3,(H,40,45)(H,41,46)/t36-/m0/s1 |
| InChIKey | BDRGAEDISYNPKH-BHVANESWSA-N |
| XLogP | 5.33 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.79 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|