C34H41N3O4S — CID 70166026
N-[1-(benzenesulfonamido)-2-oxoheptan-3-yl]-2-[2-[4-(piperidin-1-ylmethyl)phenyl]ethenyl]benzamide (PubChem CID 70166026) has the molecular formula C34H41N3O4S and a molecular weight of 587.79 g/mol. Its IUPAC name is N-[1-(benzenesulfonamido)-2-oxoheptan-3-yl]-2-[2-[4-(piperidin-1-ylmethyl)phenyl]ethenyl]benzamide.
| Compound Name | N-[1-(benzenesulfonamido)-2-oxoheptan-3-yl]-2-[2-[4-(piperidin-1-ylmethyl)phenyl]ethenyl]benzamide |
|---|---|
| PubChem CID | 70166026 |
| Molecular Formula | C34H41N3O4S |
| Molecular Weight | 587.79 g/mol |
| Exact Mass | 587.28 |
| IUPAC Name | N-[1-(benzenesulfonamido)-2-oxoheptan-3-yl]-2-[2-[4-(piperidin-1-ylmethyl)phenyl]ethenyl]benzamide |
| SMILES | CCCCC(NC(=O)c1ccccc1C=Cc1ccc(CN2CCCCC2)cc1)C(=O)CNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C34H41N3O4S/c1-2-3-16-32(33(38)25-35-42(40,41)30-13-6-4-7-14-30)36-34(39)31-15-9-8-12-29(31)22-21-27-17-19-28(20-18-27)26-37-23-10-5-11-24-37/h4,6-9,12-15,17-22,32,35H,2-3,5,10-11,16,23-26H2,1H3,(H,36,39) |
| InChIKey | BWLAFABIRIFHFC-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.79 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|