C31H33N3O7S — CID 173054148
N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-[2-[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]ethenyl]benzamide;methanesulfonic acid (PubChem CID 173054148) has the molecular formula C31H33N3O7S and a molecular weight of 591.69 g/mol. Its IUPAC name is N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-[2-[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]ethenyl]benzamide;methanesulfonic acid.
| Compound Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-[2-[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]ethenyl]benzamide;methanesulfonic acid |
|---|---|
| PubChem CID | 173054148 |
| Molecular Formula | C31H33N3O7S |
| Molecular Weight | 591.69 g/mol |
| Exact Mass | 591.20 |
| IUPAC Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-[2-[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]ethenyl]benzamide;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.NC(=O)C(=O)C(Cc1ccccc1)NC(=O)c1ccccc1C=Cc1ccc(CN2CCCC2=O)cc1 |
| InChI | InChI=1S/C30H29N3O4.CH4O3S/c31-29(36)28(35)26(19-22-7-2-1-3-8-22)32-30(37)25-10-5-4-9-24(25)17-16-21-12-14-23(15-13-21)20-33-18-6-11-27(33)34;1-5(2,3)4/h1-5,7-10,12-17,26H,6,11,18-20H2,(H2,31,36)(H,32,37);1H3,(H,2,3,4) |
| InChIKey | DUGUFYXYBWJHQT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 163.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.69 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|