C32H36N4O3 — CID 54253461
N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-[2-[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]ethenyl]benzamide (PubChem CID 54253461) has the molecular formula C32H36N4O3 and a molecular weight of 524.67 g/mol. Its IUPAC name is N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-[2-[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]ethenyl]benzamide.
| Compound Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-[2-[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]ethenyl]benzamide |
|---|---|
| PubChem CID | 54253461 |
| Molecular Formula | C32H36N4O3 |
| Molecular Weight | 524.67 g/mol |
| Exact Mass | 524.28 |
| IUPAC Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-[2-[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]ethenyl]benzamide |
| SMILES | CCN1CCN(Cc2ccc(C=Cc3ccccc3C(=O)NC(Cc3ccccc3)C(=O)C(N)=O)cc2)CC1 |
| InChI | InChI=1S/C32H36N4O3/c1-2-35-18-20-36(21-19-35)23-26-14-12-24(13-15-26)16-17-27-10-6-7-11-28(27)32(39)34-29(30(37)31(33)38)22-25-8-4-3-5-9-25/h3-17,29H,2,18-23H2,1H3,(H2,33,38)(H,34,39) |
| InChIKey | QYJOKHBHRQCQFU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.67 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|