C37H39N3O3 — CID 70163286
N-[(2S)-4-benzamido-3-oxo-1-phenylbutan-2-yl]-2-[2-[4-(diethylaminomethyl)phenyl]ethenyl]benzamide (PubChem CID 70163286) has the molecular formula C37H39N3O3 and a molecular weight of 573.74 g/mol. Its IUPAC name is N-[(2S)-4-benzamido-3-oxo-1-phenylbutan-2-yl]-2-[2-[4-(diethylaminomethyl)phenyl]ethenyl]benzamide.
| Compound Name | N-[(2S)-4-benzamido-3-oxo-1-phenylbutan-2-yl]-2-[2-[4-(diethylaminomethyl)phenyl]ethenyl]benzamide |
|---|---|
| PubChem CID | 70163286 |
| Molecular Formula | C37H39N3O3 |
| Molecular Weight | 573.74 g/mol |
| Exact Mass | 573.30 |
| IUPAC Name | N-[(2S)-4-benzamido-3-oxo-1-phenylbutan-2-yl]-2-[2-[4-(diethylaminomethyl)phenyl]ethenyl]benzamide |
| SMILES | CCN(CC)Cc1ccc(C=Cc2ccccc2C(=O)N[C@@H](Cc2ccccc2)C(=O)CNC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C37H39N3O3/c1-3-40(4-2)27-30-21-19-28(20-22-30)23-24-31-15-11-12-18-33(31)37(43)39-34(25-29-13-7-5-8-14-29)35(41)26-38-36(42)32-16-9-6-10-17-32/h5-24,34H,3-4,25-27H2,1-2H3,(H,38,42)(H,39,43)/t34-/m0/s1 |
| InChIKey | NNEQJYKBQGSRKH-UMSFTDKQSA-N |
| XLogP | 6.04 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.74 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|