C31H34N4O3 — CID 159818904
3-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-[2-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]ethenyl]benzamide (PubChem CID 159818904) has the molecular formula C31H34N4O3 and a molecular weight of 510.64 g/mol. Its IUPAC name is 3-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-[2-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]ethenyl]benzamide.
| Compound Name | 3-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-[2-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]ethenyl]benzamide |
|---|---|
| PubChem CID | 159818904 |
| Molecular Formula | C31H34N4O3 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.26 |
| IUPAC Name | 3-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-[2-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]ethenyl]benzamide |
| SMILES | CN1CCN(Cc2ccc(C=Cc3c(C(N)=O)cccc3C(Cc3ccccc3)C(=O)C(N)=O)cc2)CC1 |
| InChI | InChI=1S/C31H34N4O3/c1-34-16-18-35(19-17-34)21-24-12-10-22(11-13-24)14-15-26-25(8-5-9-27(26)30(32)37)28(29(36)31(33)38)20-23-6-3-2-4-7-23/h2-15,28H,16-21H2,1H3,(H2,32,37)(H2,33,38) |
| InChIKey | NLZAPCUTDXGRHJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 109.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|