C35H41N3O3 — CID 57282452
N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-N-[2-[4-[(4-tert-butylpiperidin-1-yl)methyl]phenyl]ethenyl]benzamide (PubChem CID 57282452) has the molecular formula C35H41N3O3 and a molecular weight of 551.73 g/mol. Its IUPAC name is N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-N-[2-[4-[(4-tert-butylpiperidin-1-yl)methyl]phenyl]ethenyl]benzamide.
| Compound Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-N-[2-[4-[(4-tert-butylpiperidin-1-yl)methyl]phenyl]ethenyl]benzamide |
|---|---|
| PubChem CID | 57282452 |
| Molecular Formula | C35H41N3O3 |
| Molecular Weight | 551.73 g/mol |
| Exact Mass | 551.31 |
| IUPAC Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-N-[2-[4-[(4-tert-butylpiperidin-1-yl)methyl]phenyl]ethenyl]benzamide |
| SMILES | CC(C)(C)C1CCN(Cc2ccc(C=CN(C(=O)c3ccccc3)C(Cc3ccccc3)C(=O)C(N)=O)cc2)CC1 |
| InChI | InChI=1S/C35H41N3O3/c1-35(2,3)30-19-21-37(22-20-30)25-28-16-14-26(15-17-28)18-23-38(34(41)29-12-8-5-9-13-29)31(32(39)33(36)40)24-27-10-6-4-7-11-27/h4-18,23,30-31H,19-22,24-25H2,1-3H3,(H2,36,40) |
| InChIKey | MIIIJFJDVOTUCU-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.73 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|