C35H41N3O3 — CID 70066220
3-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-[(E)-2-[4-[(4-tert-butylpiperidin-1-yl)methyl]phenyl]ethenyl]benzamide (PubChem CID 70066220) has the molecular formula C35H41N3O3 and a molecular weight of 551.73 g/mol. Its IUPAC name is 3-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-[(E)-2-[4-[(4-tert-butylpiperidin-1-yl)methyl]phenyl]ethenyl]benzamide.
| Compound Name | 3-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-[(E)-2-[4-[(4-tert-butylpiperidin-1-yl)methyl]phenyl]ethenyl]benzamide |
|---|---|
| PubChem CID | 70066220 |
| Molecular Formula | C35H41N3O3 |
| Molecular Weight | 551.73 g/mol |
| Exact Mass | 551.31 |
| IUPAC Name | 3-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-[(E)-2-[4-[(4-tert-butylpiperidin-1-yl)methyl]phenyl]ethenyl]benzamide |
| SMILES | CC(C)(C)C1CCN(Cc2ccc(/C=C/c3c(C(N)=O)cccc3C(Cc3ccccc3)C(=O)C(N)=O)cc2)CC1 |
| InChI | InChI=1S/C35H41N3O3/c1-35(2,3)27-18-20-38(21-19-27)23-26-14-12-24(13-15-26)16-17-29-28(10-7-11-30(29)33(36)40)31(32(39)34(37)41)22-25-8-5-4-6-9-25/h4-17,27,31H,18-23H2,1-3H3,(H2,36,40)(H2,37,41)/b17-16+ |
| InChIKey | ONJNMTNEWXTNCX-WUKNDPDISA-N |
| XLogP | 5.59 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.73 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|