C17H18ClFN2O2 — CID 66725010
(3R)-4-amino-3-[4-chloro-3-[(3-fluorophenyl)methylamino]phenyl]butanoic acid (PubChem CID 66725010) has the molecular formula C17H18ClFN2O2 and a molecular weight of 336.79 g/mol. Its IUPAC name is (3R)-4-amino-3-[4-chloro-3-[(3-fluorophenyl)methylamino]phenyl]butanoic acid.
| Compound Name | (3R)-4-amino-3-[4-chloro-3-[(3-fluorophenyl)methylamino]phenyl]butanoic acid |
|---|---|
| PubChem CID | 66725010 |
| Molecular Formula | C17H18ClFN2O2 |
| Molecular Weight | 336.79 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | (3R)-4-amino-3-[4-chloro-3-[(3-fluorophenyl)methylamino]phenyl]butanoic acid |
| SMILES | NC[C@H](CC(=O)O)c1ccc(Cl)c(NCc2cccc(F)c2)c1 |
| InChI | InChI=1S/C17H18ClFN2O2/c18-15-5-4-12(13(9-20)8-17(22)23)7-16(15)21-10-11-2-1-3-14(19)6-11/h1-7,13,21H,8-10,20H2,(H,22,23)/t13-/m0/s1 |
| InChIKey | UEHUHIYKLRZEGU-ZDUSSCGKSA-N |
| XLogP | 3.61 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.79 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |