C17H18Cl2N2O4 — CID 66725155
(3R)-4-amino-3-[4-chloro-3-[(3-nitrophenyl)methyl]phenyl]butanoic acid;hydrochloride (PubChem CID 66725155) has the molecular formula C17H18Cl2N2O4 and a molecular weight of 385.25 g/mol. Its IUPAC name is (3R)-4-amino-3-[4-chloro-3-[(3-nitrophenyl)methyl]phenyl]butanoic acid;hydrochloride.
| Compound Name | (3R)-4-amino-3-[4-chloro-3-[(3-nitrophenyl)methyl]phenyl]butanoic acid;hydrochloride |
|---|---|
| PubChem CID | 66725155 |
| Molecular Formula | C17H18Cl2N2O4 |
| Molecular Weight | 385.25 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | (3R)-4-amino-3-[4-chloro-3-[(3-nitrophenyl)methyl]phenyl]butanoic acid;hydrochloride |
| SMILES | Cl.NCC(CC(=O)O)c1ccc(Cl)c(Cc2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C17H17ClN2O4.ClH/c18-16-5-4-12(14(10-19)9-17(21)22)8-13(16)6-11-2-1-3-15(7-11)20(23)24;/h1-5,7-8,14H,6,9-10,19H2,(H,21,22);1H |
| InChIKey | BSWNBPOXBSVFQK-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 106.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.25 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|