C14H22FNO3 — CID 66725988
2-methylpropyl 2-[4-(2-fluoroethenyl)-2-oxopyrrolidin-1-yl]butanoate (PubChem CID 66725988) has the molecular formula C14H22FNO3 and a molecular weight of 271.33 g/mol. Its IUPAC name is 2-methylpropyl 2-[4-(2-fluoroethenyl)-2-oxopyrrolidin-1-yl]butanoate.
| Compound Name | 2-methylpropyl 2-[4-(2-fluoroethenyl)-2-oxopyrrolidin-1-yl]butanoate |
|---|---|
| PubChem CID | 66725988 |
| Molecular Formula | C14H22FNO3 |
| Molecular Weight | 271.33 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 2-methylpropyl 2-[4-(2-fluoroethenyl)-2-oxopyrrolidin-1-yl]butanoate |
| SMILES | CCC(C(=O)OCC(C)C)N1CC(C=CF)CC1=O |
| InChI | InChI=1S/C14H22FNO3/c1-4-12(14(18)19-9-10(2)3)16-8-11(5-6-15)7-13(16)17/h5-6,10-12H,4,7-9H2,1-3H3 |
| InChIKey | RXCOTOXIMDINMP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.33 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |