About 7-fluoro-6-[(2-methyl-1,4-diazepan-1-yl)sulfonyl]isoquinoline;dihydrochloride
7-fluoro-6-[(2-methyl-1,4-diazepan-1-yl)sulfonyl]isoquinoline;dihydrochloride (PubChem CID 66727204) has the molecular formula C15H20Cl2FN3O2S
and a molecular weight of 396.32 g/mol. Its IUPAC name is 7-fluoro-6-[(2-methyl-1,4-diazepan-1-yl)sulfonyl]isoquinoline;dihydrochloride.
Molecular Properties
| Compound Name | 7-fluoro-6-[(2-methyl-1,4-diazepan-1-yl)sulfonyl]isoquinoline;dihydrochloride |
| PubChem CID | 66727204 |
| Molecular Formula | C15H20Cl2FN3O2S |
| Molecular Weight | 396.32 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | 7-fluoro-6-[(2-methyl-1,4-diazepan-1-yl)sulfonyl]isoquinoline;dihydrochloride |
| SMILES | CC1CNCCCN1S(=O)(=O)c1cc2ccncc2cc1F.Cl.Cl |
| InChI | InChI=1S/C15H18FN3O2S.2ClH/c1-11-9-17-4-2-6-19(11)22(20,21)15-8-12-3-5-18-10-13(12)7-14(15)16;;/h3,5,7-8,10-11,17H,2,4,6,9H2,1H3;2*1H |
| InChIKey | VLTVZTMIIGXSIT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-fluoro-6-[(2-methyl-1,4-diazepan-1-yl)sulfonyl]isoquinoline;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-6-[(2-methyl-1,4-diazepan-1-yl)sulfonyl]isoquinoline;dihydrochloride?
The IUPAC name of 7-fluoro-6-[(2-methyl-1,4-diazepan-1-yl)sulfonyl]isoquinoline;dihydrochloride (CID 66727204) is 7-fluoro-6-[(2-methyl-1,4-diazepan-1-yl)sulfonyl]isoquinoline;dihydrochloride.
What is the SMILES notation for 7-fluoro-6-[(2-methyl-1,4-diazepan-1-yl)sulfonyl]isoquinoline;dihydrochloride?
The canonical SMILES for 7-fluoro-6-[(2-methyl-1,4-diazepan-1-yl)sulfonyl]isoquinoline;dihydrochloride is CC1CNCCCN1S(=O)(=O)c1cc2ccncc2cc1F.Cl.Cl.
What is the InChIKey of 7-fluoro-6-[(2-methyl-1,4-diazepan-1-yl)sulfonyl]isoquinoline;dihydrochloride?
The InChIKey is VLTVZTMIIGXSIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18FN3O2S.2ClH/c1-11-9-17-4-2-6-19(11)22(20,21)15-8-12-3-5-18-10-13(12)7-14(15)16;;/h3,5,7-8,10-11,17H,2,4,6,9H2,1H3;2*1H.
What are the key properties of 7-fluoro-6-[(2-methyl-1,4-diazepan-1-yl)sulfonyl]isoquinoline;dihydrochloride?
7-fluoro-6-[(2-methyl-1,4-diazepan-1-yl)sulfonyl]isoquinoline;dihydrochloride has a molecular weight of 396.32 g/mol, XLogP of 2.59, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-6-[(2-methyl-1,4-diazepan-1-yl)sulfonyl]isoquinoline;dihydrochloride is sourced from PubChem (CID 66727204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).