C19H24F4N4O — CID 66727648
2-amino-6-[5-[(1-cyclopropyl-2,2,2-trifluoroethyl)amino]-2-fluorophenyl]-3,5,5,6-tetramethylpyrimidin-4-one (PubChem CID 66727648) has the molecular formula C19H24F4N4O and a molecular weight of 400.42 g/mol. Its IUPAC name is 2-amino-6-[5-[(1-cyclopropyl-2,2,2-trifluoroethyl)amino]-2-fluorophenyl]-3,5,5,6-tetramethylpyrimidin-4-one.
| Compound Name | 2-amino-6-[5-[(1-cyclopropyl-2,2,2-trifluoroethyl)amino]-2-fluorophenyl]-3,5,5,6-tetramethylpyrimidin-4-one |
|---|---|
| PubChem CID | 66727648 |
| Molecular Formula | C19H24F4N4O |
| Molecular Weight | 400.42 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 2-amino-6-[5-[(1-cyclopropyl-2,2,2-trifluoroethyl)amino]-2-fluorophenyl]-3,5,5,6-tetramethylpyrimidin-4-one |
| SMILES | CN1C(=O)C(C)(C)C(C)(c2cc(NC(C3CC3)C(F)(F)F)ccc2F)N=C1N |
| InChI | InChI=1S/C19H24F4N4O/c1-17(2)15(28)27(4)16(24)26-18(17,3)12-9-11(7-8-13(12)20)25-14(10-5-6-10)19(21,22)23/h7-10,14,25H,5-6H2,1-4H3,(H2,24,26) |
| InChIKey | LXEDJJAIGPASPO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |