C21H26F4N4O5 — CID 66727807
N-[3-[(4S)-2-amino-1,4,5,5-tetramethyl-6-oxopyrimidin-4-yl]-4-fluorophenyl]-1-hydroxycyclobutane-1-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 66727807) has the molecular formula C21H26F4N4O5 and a molecular weight of 490.45 g/mol. Its IUPAC name is N-[3-[(4S)-2-amino-1,4,5,5-tetramethyl-6-oxopyrimidin-4-yl]-4-fluorophenyl]-1-hydroxycyclobutane-1-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[3-[(4S)-2-amino-1,4,5,5-tetramethyl-6-oxopyrimidin-4-yl]-4-fluorophenyl]-1-hydroxycyclobutane-1-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 66727807 |
| Molecular Formula | C21H26F4N4O5 |
| Molecular Weight | 490.45 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | N-[3-[(4S)-2-amino-1,4,5,5-tetramethyl-6-oxopyrimidin-4-yl]-4-fluorophenyl]-1-hydroxycyclobutane-1-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CN1C(=O)C(C)(C)[C@@](C)(c2cc(NC(=O)C3(O)CCC3)ccc2F)N=C1N.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H25FN4O3.C2HF3O2/c1-17(2)15(26)24(4)16(21)23-18(17,3)12-10-11(6-7-13(12)20)22-14(25)19(27)8-5-9-19;3-2(4,5)1(6)7/h6-7,10,27H,5,8-9H2,1-4H3,(H2,21,23)(H,22,25);(H,6,7)/t18-;/m1./s1 |
| InChIKey | YJBNEYKDKFVPCR-GMUIIQOCSA-N |
| XLogP | 2.34 |
| TPSA | 145.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.45 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |