C25H29FN4O2S — CID 66731327
N-tert-butyl-6-(3-cyano-1-cyclohexyl-5-fluoro-6-methylindol-2-yl)pyridine-3-sulfonamide (PubChem CID 66731327) has the molecular formula C25H29FN4O2S and a molecular weight of 468.60 g/mol. Its IUPAC name is N-tert-butyl-6-(3-cyano-1-cyclohexyl-5-fluoro-6-methylindol-2-yl)pyridine-3-sulfonamide.
| Compound Name | N-tert-butyl-6-(3-cyano-1-cyclohexyl-5-fluoro-6-methylindol-2-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 66731327 |
| Molecular Formula | C25H29FN4O2S |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | N-tert-butyl-6-(3-cyano-1-cyclohexyl-5-fluoro-6-methylindol-2-yl)pyridine-3-sulfonamide |
| SMILES | Cc1cc2c(cc1F)c(C#N)c(-c1ccc(S(=O)(=O)NC(C)(C)C)cn1)n2C1CCCCC1 |
| InChI | InChI=1S/C25H29FN4O2S/c1-16-12-23-19(13-21(16)26)20(14-27)24(30(23)17-8-6-5-7-9-17)22-11-10-18(15-28-22)33(31,32)29-25(2,3)4/h10-13,15,17,29H,5-9H2,1-4H3 |
| InChIKey | GPWVNRXWTNREPC-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |