C20H19F3N2O5S — CID 66738110
1-(2-ethylsulfonylethyl)-8-methoxy-3-[3-(trifluoromethoxy)phenyl]cinnolin-4-one (PubChem CID 66738110) has the molecular formula C20H19F3N2O5S and a molecular weight of 456.44 g/mol. Its IUPAC name is 1-(2-ethylsulfonylethyl)-8-methoxy-3-[3-(trifluoromethoxy)phenyl]cinnolin-4-one.
| Compound Name | 1-(2-ethylsulfonylethyl)-8-methoxy-3-[3-(trifluoromethoxy)phenyl]cinnolin-4-one |
|---|---|
| PubChem CID | 66738110 |
| Molecular Formula | C20H19F3N2O5S |
| Molecular Weight | 456.44 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | 1-(2-ethylsulfonylethyl)-8-methoxy-3-[3-(trifluoromethoxy)phenyl]cinnolin-4-one |
| SMILES | CCS(=O)(=O)CCn1nc(-c2cccc(OC(F)(F)F)c2)c(=O)c2cccc(OC)c21 |
| InChI | InChI=1S/C20H19F3N2O5S/c1-3-31(27,28)11-10-25-18-15(8-5-9-16(18)29-2)19(26)17(24-25)13-6-4-7-14(12-13)30-20(21,22)23/h4-9,12H,3,10-11H2,1-2H3 |
| InChIKey | USMVLMOHRRQBBA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 87.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |