C10H9F3N2O — CID 133055459
1,3-dimethyl-7-(trifluoromethoxy)indazole (PubChem CID 133055459) has the molecular formula C10H9F3N2O and a molecular weight of 230.19 g/mol. Its IUPAC name is 1,3-dimethyl-7-(trifluoromethoxy)indazole.
| Compound Name | 1,3-dimethyl-7-(trifluoromethoxy)indazole |
|---|---|
| PubChem CID | 133055459 |
| Molecular Formula | C10H9F3N2O |
| Molecular Weight | 230.19 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 1,3-dimethyl-7-(trifluoromethoxy)indazole |
| SMILES | Cc1nn(C)c2c(OC(F)(F)F)cccc12 |
| InChI | InChI=1S/C10H9F3N2O/c1-6-7-4-3-5-8(16-10(11,12)13)9(7)15(2)14-6/h3-5H,1-2H3 |
| InChIKey | GLWKHJNLSZBABC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.19 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |