C19H36N2O3 — CID 66739757
tert-butyl-[1-(4-propoxycyclohexyl)piperidin-4-yl]carbamic acid (PubChem CID 66739757) has the molecular formula C19H36N2O3 and a molecular weight of 340.51 g/mol. Its IUPAC name is tert-butyl-[1-(4-propoxycyclohexyl)piperidin-4-yl]carbamic acid.
| Compound Name | tert-butyl-[1-(4-propoxycyclohexyl)piperidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 66739757 |
| Molecular Formula | C19H36N2O3 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.27 |
| IUPAC Name | tert-butyl-[1-(4-propoxycyclohexyl)piperidin-4-yl]carbamic acid |
| SMILES | CCCOC1CCC(N2CCC(N(C(=O)O)C(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C19H36N2O3/c1-5-14-24-17-8-6-15(7-9-17)20-12-10-16(11-13-20)21(18(22)23)19(2,3)4/h15-17H,5-14H2,1-4H3,(H,22,23) |
| InChIKey | ZCONFOYZKZVEHI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |